C24H28N2O6S — CID 53000141
N-[(4-butoxyphenyl)methyl]-2-[5-(4-methoxyphenyl)-4-methyl-1,1,3-trioxo-1,2-thiazol-2-yl]acetamide (PubChem CID 53000141) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is N-[(4-butoxyphenyl)methyl]-2-[5-(4-methoxyphenyl)-4-methyl-1,1,3-trioxo-1,2-thiazol-2-yl]acetamide.
| Compound Name | N-[(4-butoxyphenyl)methyl]-2-[5-(4-methoxyphenyl)-4-methyl-1,1,3-trioxo-1,2-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 53000141 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | N-[(4-butoxyphenyl)methyl]-2-[5-(4-methoxyphenyl)-4-methyl-1,1,3-trioxo-1,2-thiazol-2-yl]acetamide |
| SMILES | CCCCOc1ccc(CNC(=O)CN2C(=O)C(C)=C(c3ccc(OC)cc3)S2(=O)=O)cc1 |
| InChI | InChI=1S/C24H28N2O6S/c1-4-5-14-32-21-10-6-18(7-11-21)15-25-22(27)16-26-24(28)17(2)23(33(26,29)30)19-8-12-20(31-3)13-9-19/h6-13H,4-5,14-16H2,1-3H3,(H,25,27) |
| InChIKey | FLXIERLIOKZBEE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|