C26H23N3O5 — CID 53000732
N-benzyl-2-[6,7-dimethoxy-4-oxo-3-(pyridine-4-carbonyl)quinolin-1-yl]acetamide (PubChem CID 53000732) has the molecular formula C26H23N3O5 and a molecular weight of 457.49 g/mol. Its IUPAC name is N-benzyl-2-[6,7-dimethoxy-4-oxo-3-(pyridine-4-carbonyl)quinolin-1-yl]acetamide.
| Compound Name | N-benzyl-2-[6,7-dimethoxy-4-oxo-3-(pyridine-4-carbonyl)quinolin-1-yl]acetamide |
|---|---|
| PubChem CID | 53000732 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N-benzyl-2-[6,7-dimethoxy-4-oxo-3-(pyridine-4-carbonyl)quinolin-1-yl]acetamide |
| SMILES | COc1cc2c(=O)c(C(=O)c3ccncc3)cn(CC(=O)NCc3ccccc3)c2cc1OC |
| InChI | InChI=1S/C26H23N3O5/c1-33-22-12-19-21(13-23(22)34-2)29(16-24(30)28-14-17-6-4-3-5-7-17)15-20(26(19)32)25(31)18-8-10-27-11-9-18/h3-13,15H,14,16H2,1-2H3,(H,28,30) |
| InChIKey | AAKUFNUGYAVKNL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |