C28H27N3O4 — CID 53000804
2-[7-methoxy-4-oxo-3-(pyridine-4-carbonyl)quinolin-1-yl]-N-(4-phenylbutan-2-yl)acetamide (PubChem CID 53000804) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is 2-[7-methoxy-4-oxo-3-(pyridine-4-carbonyl)quinolin-1-yl]-N-(4-phenylbutan-2-yl)acetamide.
| Compound Name | 2-[7-methoxy-4-oxo-3-(pyridine-4-carbonyl)quinolin-1-yl]-N-(4-phenylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 53000804 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 2-[7-methoxy-4-oxo-3-(pyridine-4-carbonyl)quinolin-1-yl]-N-(4-phenylbutan-2-yl)acetamide |
| SMILES | COc1ccc2c(=O)c(C(=O)c3ccncc3)cn(CC(=O)NC(C)CCc3ccccc3)c2c1 |
| InChI | InChI=1S/C28H27N3O4/c1-19(8-9-20-6-4-3-5-7-20)30-26(32)18-31-17-24(27(33)21-12-14-29-15-13-21)28(34)23-11-10-22(35-2)16-25(23)31/h3-7,10-17,19H,8-9,18H2,1-2H3,(H,30,32) |
| InChIKey | UOQUAJKFUGITLP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |