C21H34N4O3 — CID 53006151
N-(3-morpholin-4-ylpropyl)-1-(3,4,5-trimethyl-1H-pyrrole-2-carbonyl)piperidine-3-carboxamide (PubChem CID 53006151) has the molecular formula C21H34N4O3 and a molecular weight of 390.53 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-1-(3,4,5-trimethyl-1H-pyrrole-2-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-1-(3,4,5-trimethyl-1H-pyrrole-2-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53006151 |
| Molecular Formula | C21H34N4O3 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-1-(3,4,5-trimethyl-1H-pyrrole-2-carbonyl)piperidine-3-carboxamide |
| SMILES | Cc1[nH]c(C(=O)N2CCCC(C(=O)NCCCN3CCOCC3)C2)c(C)c1C |
| InChI | InChI=1S/C21H34N4O3/c1-15-16(2)19(23-17(15)3)21(27)25-9-4-6-18(14-25)20(26)22-7-5-8-24-10-12-28-13-11-24/h18,23H,4-14H2,1-3H3,(H,22,26) |
| InChIKey | KQAKJJYHGPFPSK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|