C17H18BrN3O5S — CID 53006772
2-[3-(4-bromophenyl)sulfonyl-6-oxopyridazin-1-yl]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 53006772) has the molecular formula C17H18BrN3O5S and a molecular weight of 456.32 g/mol. Its IUPAC name is 2-[3-(4-bromophenyl)sulfonyl-6-oxopyridazin-1-yl]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[3-(4-bromophenyl)sulfonyl-6-oxopyridazin-1-yl]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 53006772 |
| Molecular Formula | C17H18BrN3O5S |
| Molecular Weight | 456.32 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | 2-[3-(4-bromophenyl)sulfonyl-6-oxopyridazin-1-yl]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1nc(S(=O)(=O)c2ccc(Br)cc2)ccc1=O)NCC1CCCO1 |
| InChI | InChI=1S/C17H18BrN3O5S/c18-12-3-5-14(6-4-12)27(24,25)16-7-8-17(23)21(20-16)11-15(22)19-10-13-2-1-9-26-13/h3-8,13H,1-2,9-11H2,(H,19,22) |
| InChIKey | FLMNTCDSCJEPPG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |