C25H23N5O — CID 53007704
N-[2-(1H-indol-3-yl)ethyl]-1-[(4-methylphenyl)methyl]benzotriazole-5-carboxamide (PubChem CID 53007704) has the molecular formula C25H23N5O and a molecular weight of 409.49 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-1-[(4-methylphenyl)methyl]benzotriazole-5-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-1-[(4-methylphenyl)methyl]benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 53007704 |
| Molecular Formula | C25H23N5O |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-1-[(4-methylphenyl)methyl]benzotriazole-5-carboxamide |
| SMILES | Cc1ccc(Cn2nnc3cc(C(=O)NCCc4c[nH]c5ccccc45)ccc32)cc1 |
| InChI | InChI=1S/C25H23N5O/c1-17-6-8-18(9-7-17)16-30-24-11-10-19(14-23(24)28-29-30)25(31)26-13-12-20-15-27-22-5-3-2-4-21(20)22/h2-11,14-15,27H,12-13,16H2,1H3,(H,26,31) |
| InChIKey | WEUMJTYBQUFXLK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |