C23H25N3O3 — CID 53011517
3-[6-(4-methoxyphenyl)pyrimidin-4-yl]oxy-N-pentylbenzamide (PubChem CID 53011517) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 3-[6-(4-methoxyphenyl)pyrimidin-4-yl]oxy-N-pentylbenzamide.
| Compound Name | 3-[6-(4-methoxyphenyl)pyrimidin-4-yl]oxy-N-pentylbenzamide |
|---|---|
| PubChem CID | 53011517 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 3-[6-(4-methoxyphenyl)pyrimidin-4-yl]oxy-N-pentylbenzamide |
| SMILES | CCCCCNC(=O)c1cccc(Oc2cc(-c3ccc(OC)cc3)ncn2)c1 |
| InChI | InChI=1S/C23H25N3O3/c1-3-4-5-13-24-23(27)18-7-6-8-20(14-18)29-22-15-21(25-16-26-22)17-9-11-19(28-2)12-10-17/h6-12,14-16H,3-5,13H2,1-2H3,(H,24,27) |
| InChIKey | BJRUISGJZLSMMM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|