C26H23N3O3 — CID 53021217
3-[6-(4-methoxyphenoxy)pyrimidin-4-yl]-N-[(3-methylphenyl)methyl]benzamide (PubChem CID 53021217) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is 3-[6-(4-methoxyphenoxy)pyrimidin-4-yl]-N-[(3-methylphenyl)methyl]benzamide.
| Compound Name | 3-[6-(4-methoxyphenoxy)pyrimidin-4-yl]-N-[(3-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 53021217 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 3-[6-(4-methoxyphenoxy)pyrimidin-4-yl]-N-[(3-methylphenyl)methyl]benzamide |
| SMILES | COc1ccc(Oc2cc(-c3cccc(C(=O)NCc4cccc(C)c4)c3)ncn2)cc1 |
| InChI | InChI=1S/C26H23N3O3/c1-18-5-3-6-19(13-18)16-27-26(30)21-8-4-7-20(14-21)24-15-25(29-17-28-24)32-23-11-9-22(31-2)10-12-23/h3-15,17H,16H2,1-2H3,(H,27,30) |
| InChIKey | PBXTUIXOOUMJAX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |