C29H30N4O3 — CID 53115089
N-[[4-(diethylamino)phenyl]methyl]-4-[6-(4-methoxyphenoxy)pyrimidin-4-yl]benzamide (PubChem CID 53115089) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methyl]-4-[6-(4-methoxyphenoxy)pyrimidin-4-yl]benzamide.
| Compound Name | N-[[4-(diethylamino)phenyl]methyl]-4-[6-(4-methoxyphenoxy)pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 53115089 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methyl]-4-[6-(4-methoxyphenoxy)pyrimidin-4-yl]benzamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)c2ccc(-c3cc(Oc4ccc(OC)cc4)ncn3)cc2)cc1 |
| InChI | InChI=1S/C29H30N4O3/c1-4-33(5-2)24-12-6-21(7-13-24)19-30-29(34)23-10-8-22(9-11-23)27-18-28(32-20-31-27)36-26-16-14-25(35-3)15-17-26/h6-18,20H,4-5,19H2,1-3H3,(H,30,34) |
| InChIKey | OEYIISXODFKUOA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|