C26H21N3O5 — CID 53021089
N-(1,3-benzodioxol-5-ylmethyl)-4-[6-(4-methoxyphenoxy)pyrimidin-4-yl]benzamide (PubChem CID 53021089) has the molecular formula C26H21N3O5 and a molecular weight of 455.47 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-[6-(4-methoxyphenoxy)pyrimidin-4-yl]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-[6-(4-methoxyphenoxy)pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 53021089 |
| Molecular Formula | C26H21N3O5 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-[6-(4-methoxyphenoxy)pyrimidin-4-yl]benzamide |
| SMILES | COc1ccc(Oc2cc(-c3ccc(C(=O)NCc4ccc5c(c4)OCO5)cc3)ncn2)cc1 |
| InChI | InChI=1S/C26H21N3O5/c1-31-20-7-9-21(10-8-20)34-25-13-22(28-15-29-25)18-3-5-19(6-4-18)26(30)27-14-17-2-11-23-24(12-17)33-16-32-23/h2-13,15H,14,16H2,1H3,(H,27,30) |
| InChIKey | YUUDHBLKEVUMMX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |