C13H10FN5O — CID 53014308
1-(3-fluorophenyl)-3-([1,2,4]triazolo[4,3-a]pyridin-6-yl)urea (PubChem CID 53014308) has the molecular formula C13H10FN5O and a molecular weight of 271.25 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-([1,2,4]triazolo[4,3-a]pyridin-6-yl)urea.
| Compound Name | 1-(3-fluorophenyl)-3-([1,2,4]triazolo[4,3-a]pyridin-6-yl)urea |
|---|---|
| PubChem CID | 53014308 |
| Molecular Formula | C13H10FN5O |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 1-(3-fluorophenyl)-3-([1,2,4]triazolo[4,3-a]pyridin-6-yl)urea |
| SMILES | O=C(Nc1cccc(F)c1)Nc1ccc2nncn2c1 |
| InChI | InChI=1S/C13H10FN5O/c14-9-2-1-3-10(6-9)16-13(20)17-11-4-5-12-18-15-8-19(12)7-11/h1-8H,(H2,16,17,20) |
| InChIKey | GWKRSQHTBKVLSH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |