About 2-(dimethylamino)-N,N-dimethylpyridine-3-carboxamide
2-(dimethylamino)-N,N-dimethylpyridine-3-carboxamide (PubChem CID 53015798) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(dimethylamino)-N,N-dimethylpyridine-3-carboxamide.
Analyze 2-(dimethylamino)-N,N-dimethylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-N,N-dimethylpyridine-3-carboxamide?
The IUPAC name of 2-(dimethylamino)-N,N-dimethylpyridine-3-carboxamide (CID 53015798) is 2-(dimethylamino)-N,N-dimethylpyridine-3-carboxamide.
What is the SMILES notation for 2-(dimethylamino)-N,N-dimethylpyridine-3-carboxamide?
The canonical SMILES for 2-(dimethylamino)-N,N-dimethylpyridine-3-carboxamide is CN(C)C(=O)c1cccnc1N(C)C.
What is the InChIKey of 2-(dimethylamino)-N,N-dimethylpyridine-3-carboxamide?
The InChIKey is KUQZVEAIMJJMAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O/c1-12(2)9-8(6-5-7-11-9)10(14)13(3)4/h5-7H,1-4H3.
What are the key properties of 2-(dimethylamino)-N,N-dimethylpyridine-3-carboxamide?
2-(dimethylamino)-N,N-dimethylpyridine-3-carboxamide has a molecular weight of 193.25 g/mol, XLogP of 0.85, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-N,N-dimethylpyridine-3-carboxamide is sourced from PubChem (CID 53015798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).