C8H9N3O3S — CID 141318752
N,N-dimethyl-2-(sulfonylamino)pyridine-3-carboxamide (PubChem CID 141318752) has the molecular formula C8H9N3O3S and a molecular weight of 227.25 g/mol. Its IUPAC name is N,N-dimethyl-2-(sulfonylamino)pyridine-3-carboxamide.
| Compound Name | N,N-dimethyl-2-(sulfonylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141318752 |
| Molecular Formula | C8H9N3O3S |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | N,N-dimethyl-2-(sulfonylamino)pyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1cccnc1N=S(=O)=O |
| InChI | InChI=1S/C8H9N3O3S/c1-11(2)8(12)6-4-3-5-9-7(6)10-15(13)14/h3-5H,1-2H3 |
| InChIKey | CAQYHSHBKLDTBK-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 79.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |