C7H5N3O4S — CID 174561201
2-N-sulfonylpyridine-2,3-dicarboxamide (PubChem CID 174561201) has the molecular formula C7H5N3O4S and a molecular weight of 227.20 g/mol. Its IUPAC name is 2-N-sulfonylpyridine-2,3-dicarboxamide.
| Compound Name | 2-N-sulfonylpyridine-2,3-dicarboxamide |
|---|---|
| PubChem CID | 174561201 |
| Molecular Formula | C7H5N3O4S |
| Molecular Weight | 227.20 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | 2-N-sulfonylpyridine-2,3-dicarboxamide |
| SMILES | NC(=O)c1cccnc1C(=O)N=S(=O)=O |
| InChI | InChI=1S/C7H5N3O4S/c8-6(11)4-2-1-3-9-5(4)7(12)10-15(13)14/h1-3H,(H2,8,11) |
| InChIKey | LTLYMUMYKLREPX-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.20 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |