C9H11N3O3 — CID 86150893
3-N-(2-hydroxyethyl)pyridine-2,3-dicarboxamide (PubChem CID 86150893) has the molecular formula C9H11N3O3 and a molecular weight of 209.21 g/mol. Its IUPAC name is 3-N-(2-hydroxyethyl)pyridine-2,3-dicarboxamide.
| Compound Name | 3-N-(2-hydroxyethyl)pyridine-2,3-dicarboxamide |
|---|---|
| PubChem CID | 86150893 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 3-N-(2-hydroxyethyl)pyridine-2,3-dicarboxamide |
| SMILES | NC(=O)c1ncccc1C(=O)NCCO |
| InChI | InChI=1S/C9H11N3O3/c10-8(14)7-6(2-1-3-11-7)9(15)12-4-5-13/h1-3,13H,4-5H2,(H2,10,14)(H,12,15) |
| InChIKey | JJNRJGLIFCLYCH-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |