C13H14ClN3O — CID 53016644
8-chloro-N,N-dimethyl-2-(methylamino)quinoline-4-carboxamide (PubChem CID 53016644) has the molecular formula C13H14ClN3O and a molecular weight of 263.73 g/mol. Its IUPAC name is 8-chloro-N,N-dimethyl-2-(methylamino)quinoline-4-carboxamide.
| Compound Name | 8-chloro-N,N-dimethyl-2-(methylamino)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 53016644 |
| Molecular Formula | C13H14ClN3O |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 8-chloro-N,N-dimethyl-2-(methylamino)quinoline-4-carboxamide |
| SMILES | CNc1cc(C(=O)N(C)C)c2cccc(Cl)c2n1 |
| InChI | InChI=1S/C13H14ClN3O/c1-15-11-7-9(13(18)17(2)3)8-5-4-6-10(14)12(8)16-11/h4-7H,1-3H3,(H,15,16) |
| InChIKey | NNZPPOXOOUCUBU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |