C8H15N3O2 — CID 53017583
N,2,2-trimethyl-3-oxopiperazine-1-carboxamide (PubChem CID 53017583) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is N,2,2-trimethyl-3-oxopiperazine-1-carboxamide.
| Compound Name | N,2,2-trimethyl-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 53017583 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | N,2,2-trimethyl-3-oxopiperazine-1-carboxamide |
| SMILES | CNC(=O)N1CCNC(=O)C1(C)C |
| InChI | InChI=1S/C8H15N3O2/c1-8(2)6(12)10-4-5-11(8)7(13)9-3/h4-5H2,1-3H3,(H,9,13)(H,10,12) |
| InChIKey | QCNUDXMZKMBUTI-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |