C7H15ClN2O — CID 68554123
1,3,3-trimethylpiperazin-2-one;hydrochloride (PubChem CID 68554123) has the molecular formula C7H15ClN2O and a molecular weight of 178.66 g/mol. Its IUPAC name is 1,3,3-trimethylpiperazin-2-one;hydrochloride.
| Compound Name | 1,3,3-trimethylpiperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 68554123 |
| Molecular Formula | C7H15ClN2O |
| Molecular Weight | 178.66 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 1,3,3-trimethylpiperazin-2-one;hydrochloride |
| SMILES | CN1CCNC(C)(C)C1=O.Cl |
| InChI | InChI=1S/C7H14N2O.ClH/c1-7(2)6(10)9(3)5-4-8-7;/h8H,4-5H2,1-3H3;1H |
| InChIKey | NTLTZZRCZFKPCN-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.66 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |