C23H25N3O — CID 53020839
6-methyl-N-(3-methylphenyl)-4-piperidin-1-ylquinoline-2-carboxamide (PubChem CID 53020839) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is 6-methyl-N-(3-methylphenyl)-4-piperidin-1-ylquinoline-2-carboxamide.
| Compound Name | 6-methyl-N-(3-methylphenyl)-4-piperidin-1-ylquinoline-2-carboxamide |
|---|---|
| PubChem CID | 53020839 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 6-methyl-N-(3-methylphenyl)-4-piperidin-1-ylquinoline-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cc(N3CCCCC3)c3cc(C)ccc3n2)c1 |
| InChI | InChI=1S/C23H25N3O/c1-16-7-6-8-18(13-16)24-23(27)21-15-22(26-11-4-3-5-12-26)19-14-17(2)9-10-20(19)25-21/h6-10,13-15H,3-5,11-12H2,1-2H3,(H,24,27) |
| InChIKey | KKOFRKNHGJHFDL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |