C20H20N2O3 — CID 5302093
3-benzyl-5-methyl-1-(2-phenoxyethyl)pyrimidine-2,4-dione (PubChem CID 5302093) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 3-benzyl-5-methyl-1-(2-phenoxyethyl)pyrimidine-2,4-dione.
| Compound Name | 3-benzyl-5-methyl-1-(2-phenoxyethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 5302093 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 3-benzyl-5-methyl-1-(2-phenoxyethyl)pyrimidine-2,4-dione |
| SMILES | Cc1cn(CCOc2ccccc2)c(=O)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C20H20N2O3/c1-16-14-21(12-13-25-18-10-6-3-7-11-18)20(24)22(19(16)23)15-17-8-4-2-5-9-17/h2-11,14H,12-13,15H2,1H3 |
| InChIKey | ZRFVCCOBGCZZCE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |