C12H11IN2O2 — CID 79785336
3-benzyl-5-iodo-1-methylpyrimidine-2,4-dione (PubChem CID 79785336) has the molecular formula C12H11IN2O2 and a molecular weight of 342.14 g/mol. Its IUPAC name is 3-benzyl-5-iodo-1-methylpyrimidine-2,4-dione.
| Compound Name | 3-benzyl-5-iodo-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 79785336 |
| Molecular Formula | C12H11IN2O2 |
| Molecular Weight | 342.14 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 3-benzyl-5-iodo-1-methylpyrimidine-2,4-dione |
| SMILES | Cn1cc(I)c(=O)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C12H11IN2O2/c1-14-8-10(13)11(16)15(12(14)17)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3 |
| InChIKey | MBSAUXVMMYGOET-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.14 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|