C9H13IN2O3 — CID 79784395
3-(2-ethoxyethyl)-5-iodo-1-methylpyrimidine-2,4-dione (PubChem CID 79784395) has the molecular formula C9H13IN2O3 and a molecular weight of 324.12 g/mol. Its IUPAC name is 3-(2-ethoxyethyl)-5-iodo-1-methylpyrimidine-2,4-dione.
| Compound Name | 3-(2-ethoxyethyl)-5-iodo-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 79784395 |
| Molecular Formula | C9H13IN2O3 |
| Molecular Weight | 324.12 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 3-(2-ethoxyethyl)-5-iodo-1-methylpyrimidine-2,4-dione |
| SMILES | CCOCCn1c(=O)c(I)cn(C)c1=O |
| InChI | InChI=1S/C9H13IN2O3/c1-3-15-5-4-12-8(13)7(10)6-11(2)9(12)14/h6H,3-5H2,1-2H3 |
| InChIKey | ZXMJYKKIQACEGT-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.12 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|