C22H24N4O5 — CID 5302171
N-[3-[methyl-[2-(2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]propyl]-N'-(4-methylphenyl)oxamide (PubChem CID 5302171) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is N-[3-[methyl-[2-(2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]propyl]-N'-(4-methylphenyl)oxamide.
| Compound Name | N-[3-[methyl-[2-(2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]propyl]-N'-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 5302171 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-[3-[methyl-[2-(2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]propyl]-N'-(4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NCCCN(C)C(=O)Cn2c(=O)oc3ccccc32)cc1 |
| InChI | InChI=1S/C22H24N4O5/c1-15-8-10-16(11-9-15)24-21(29)20(28)23-12-5-13-25(2)19(27)14-26-17-6-3-4-7-18(17)31-22(26)30/h3-4,6-11H,5,12-14H2,1-2H3,(H,23,28)(H,24,29) |
| InChIKey | NKTFOCYACLKJRA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|