C20H21N3O6 — CID 20981791
N-ethyl-N'-(4-methylphenyl)oxamide;2-(2-oxo-1,3-benzoxazol-3-yl)acetic acid (PubChem CID 20981791) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is N-ethyl-N'-(4-methylphenyl)oxamide;2-(2-oxo-1,3-benzoxazol-3-yl)acetic acid.
| Compound Name | N-ethyl-N'-(4-methylphenyl)oxamide;2-(2-oxo-1,3-benzoxazol-3-yl)acetic acid |
|---|---|
| PubChem CID | 20981791 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-ethyl-N'-(4-methylphenyl)oxamide;2-(2-oxo-1,3-benzoxazol-3-yl)acetic acid |
| SMILES | CCNC(=O)C(=O)Nc1ccc(C)cc1.O=C(O)Cn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C11H14N2O2.C9H7NO4/c1-3-12-10(14)11(15)13-9-6-4-8(2)5-7-9;11-8(12)5-10-6-3-1-2-4-7(6)14-9(10)13/h4-7H,3H2,1-2H3,(H,12,14)(H,13,15);1-4H,5H2,(H,11,12) |
| InChIKey | GDTNFACULBWLMP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 130.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|