C24H24N6O2 — CID 53021993
5-[6-[4-(4-methoxyphenyl)piperazin-1-yl]pyridazin-3-yl]-3-(4-methylphenyl)-1,2,4-oxadiazole (PubChem CID 53021993) has the molecular formula C24H24N6O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 5-[6-[4-(4-methoxyphenyl)piperazin-1-yl]pyridazin-3-yl]-3-(4-methylphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[6-[4-(4-methoxyphenyl)piperazin-1-yl]pyridazin-3-yl]-3-(4-methylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 53021993 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 5-[6-[4-(4-methoxyphenyl)piperazin-1-yl]pyridazin-3-yl]-3-(4-methylphenyl)-1,2,4-oxadiazole |
| SMILES | COc1ccc(N2CCN(c3ccc(-c4nc(-c5ccc(C)cc5)no4)nn3)CC2)cc1 |
| InChI | InChI=1S/C24H24N6O2/c1-17-3-5-18(6-4-17)23-25-24(32-28-23)21-11-12-22(27-26-21)30-15-13-29(14-16-30)19-7-9-20(31-2)10-8-19/h3-12H,13-16H2,1-2H3 |
| InChIKey | LMWRAPOHYUEYTE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 80.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|