C21H25N4O2+ — CID 3394509
5-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-3-(4-methylphenyl)-1,2,4-oxadiazole (PubChem CID 3394509) has the molecular formula C21H25N4O2+ and a molecular weight of 365.46 g/mol. Its IUPAC name is 5-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-3-(4-methylphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-3-(4-methylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 3394509 |
| Molecular Formula | C21H25N4O2+ |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 5-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-3-(4-methylphenyl)-1,2,4-oxadiazole |
| SMILES | COc1ccc(N2CC[NH+](Cc3nc(-c4ccc(C)cc4)no3)CC2)cc1 |
| InChI | InChI=1S/C21H24N4O2/c1-16-3-5-17(6-4-16)21-22-20(27-23-21)15-24-11-13-25(14-12-24)18-7-9-19(26-2)10-8-18/h3-10H,11-15H2,1-2H3/p+1 |
| InChIKey | SIDHMUNGILKSGM-UHFFFAOYSA-O |
| XLogP | 1.96 |
| TPSA | 55.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|