C20H23N4O2+ — CID 2214079
5-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-3-phenyl-1,2,4-oxadiazole (PubChem CID 2214079) has the molecular formula C20H23N4O2+ and a molecular weight of 351.43 g/mol. Its IUPAC name is 5-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-3-phenyl-1,2,4-oxadiazole.
| Compound Name | 5-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-3-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 2214079 |
| Molecular Formula | C20H23N4O2+ |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 5-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-3-phenyl-1,2,4-oxadiazole |
| SMILES | COc1ccc(N2CC[NH+](Cc3nc(-c4ccccc4)no3)CC2)cc1 |
| InChI | InChI=1S/C20H22N4O2/c1-25-18-9-7-17(8-10-18)24-13-11-23(12-14-24)15-19-21-20(22-26-19)16-5-3-2-4-6-16/h2-10H,11-15H2,1H3/p+1 |
| InChIKey | DOJRRUFAWLPXOQ-UHFFFAOYSA-O |
| XLogP | 1.65 |
| TPSA | 55.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|