C14H18N3O+ — CID 9450127
3-phenyl-5-(piperidin-1-ium-1-ylmethyl)-1,2,4-oxadiazole (PubChem CID 9450127) has the molecular formula C14H18N3O+ and a molecular weight of 244.32 g/mol. Its IUPAC name is 3-phenyl-5-(piperidin-1-ium-1-ylmethyl)-1,2,4-oxadiazole.
| Compound Name | 3-phenyl-5-(piperidin-1-ium-1-ylmethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 9450127 |
| Molecular Formula | C14H18N3O+ |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 3-phenyl-5-(piperidin-1-ium-1-ylmethyl)-1,2,4-oxadiazole |
| SMILES | c1ccc(-c2noc(C[NH+]3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C14H17N3O/c1-3-7-12(8-4-1)14-15-13(18-16-14)11-17-9-5-2-6-10-17/h1,3-4,7-8H,2,5-6,9-11H2/p+1 |
| InChIKey | RAVKWEKARDGYPQ-UHFFFAOYSA-O |
| XLogP | 1.31 |
| TPSA | 43.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |