C20H18FN3O4S — CID 53024612
2-[benzyl(methyl)amino]-5-[(3-fluorophenyl)sulfonylamino]pyridine-3-carboxylic acid (PubChem CID 53024612) has the molecular formula C20H18FN3O4S and a molecular weight of 415.45 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]-5-[(3-fluorophenyl)sulfonylamino]pyridine-3-carboxylic acid.
| Compound Name | 2-[benzyl(methyl)amino]-5-[(3-fluorophenyl)sulfonylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 53024612 |
| Molecular Formula | C20H18FN3O4S |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 2-[benzyl(methyl)amino]-5-[(3-fluorophenyl)sulfonylamino]pyridine-3-carboxylic acid |
| SMILES | CN(Cc1ccccc1)c1ncc(NS(=O)(=O)c2cccc(F)c2)cc1C(=O)O |
| InChI | InChI=1S/C20H18FN3O4S/c1-24(13-14-6-3-2-4-7-14)19-18(20(25)26)11-16(12-22-19)23-29(27,28)17-9-5-8-15(21)10-17/h2-12,23H,13H2,1H3,(H,25,26) |
| InChIKey | AOCKZRFOLZGVPE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |