C22H29N7OS2 — CID 5302799
11-(4,6-dithiomorpholin-4-yl-1,3,5-triazin-2-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 5302799) has the molecular formula C22H29N7OS2 and a molecular weight of 471.66 g/mol. Its IUPAC name is 11-(4,6-dithiomorpholin-4-yl-1,3,5-triazin-2-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | 11-(4,6-dithiomorpholin-4-yl-1,3,5-triazin-2-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 5302799 |
| Molecular Formula | C22H29N7OS2 |
| Molecular Weight | 471.66 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 11-(4,6-dithiomorpholin-4-yl-1,3,5-triazin-2-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=c1cccc2n1CC1CC2CN(c2nc(N3CCSCC3)nc(N3CCSCC3)n2)C1 |
| InChI | InChI=1S/C22H29N7OS2/c30-19-3-1-2-18-17-12-16(14-29(18)19)13-28(15-17)22-24-20(26-4-8-31-9-5-26)23-21(25-22)27-6-10-32-11-7-27/h1-3,16-17H,4-15H2 |
| InChIKey | GVHJEPXIVNDBHV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 70.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.66 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |