C14H17N6O3- — CID 163173568
[2-methyl-3-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-1H-1,2,4-triazol-5-ylidene]-dioxidoazanium (PubChem CID 163173568) has the molecular formula C14H17N6O3- and a molecular weight of 317.33 g/mol. Its IUPAC name is [2-methyl-3-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-1H-1,2,4-triazol-5-ylidene]-dioxidoazanium.
| Compound Name | [2-methyl-3-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-1H-1,2,4-triazol-5-ylidene]-dioxidoazanium |
|---|---|
| PubChem CID | 163173568 |
| Molecular Formula | C14H17N6O3- |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | [2-methyl-3-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-1H-1,2,4-triazol-5-ylidene]-dioxidoazanium |
| SMILES | Cn1[nH]c(=[N+]([O-])[O-])nc1N1C[C@H]2C[C@@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C14H17N6O3/c1-17-14(15-13(16-17)20(22)23)18-6-9-5-10(8-18)11-3-2-4-12(21)19(11)7-9/h2-4,9-10,16H,5-8H2,1H3/q-1/t9-,10+/m1/s1 |
| InChIKey | ZAVLUHRRLJJWFW-ZJUUUORDSA-N |
| XLogP | -0.70 |
| TPSA | 107.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|