C23H33N5O3S — CID 53029147
1-(1-ethylimidazol-4-yl)sulfonyl-N-[4-(4-methylpiperidin-1-yl)phenyl]piperidine-4-carboxamide (PubChem CID 53029147) has the molecular formula C23H33N5O3S and a molecular weight of 459.62 g/mol. Its IUPAC name is 1-(1-ethylimidazol-4-yl)sulfonyl-N-[4-(4-methylpiperidin-1-yl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(1-ethylimidazol-4-yl)sulfonyl-N-[4-(4-methylpiperidin-1-yl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53029147 |
| Molecular Formula | C23H33N5O3S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 1-(1-ethylimidazol-4-yl)sulfonyl-N-[4-(4-methylpiperidin-1-yl)phenyl]piperidine-4-carboxamide |
| SMILES | CCn1cnc(S(=O)(=O)N2CCC(C(=O)Nc3ccc(N4CCC(C)CC4)cc3)CC2)c1 |
| InChI | InChI=1S/C23H33N5O3S/c1-3-26-16-22(24-17-26)32(30,31)28-14-10-19(11-15-28)23(29)25-20-4-6-21(7-5-20)27-12-8-18(2)9-13-27/h4-7,16-19H,3,8-15H2,1-2H3,(H,25,29) |
| InChIKey | LZJVQHFRAAZHQI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|