C18H23BrN4O3S — CID 53085528
N-[(4-bromophenyl)methyl]-1-(1-ethylimidazol-4-yl)sulfonylpiperidine-4-carboxamide (PubChem CID 53085528) has the molecular formula C18H23BrN4O3S and a molecular weight of 455.38 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-1-(1-ethylimidazol-4-yl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(4-bromophenyl)methyl]-1-(1-ethylimidazol-4-yl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 53085528 |
| Molecular Formula | C18H23BrN4O3S |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-1-(1-ethylimidazol-4-yl)sulfonylpiperidine-4-carboxamide |
| SMILES | CCn1cnc(S(=O)(=O)N2CCC(C(=O)NCc3ccc(Br)cc3)CC2)c1 |
| InChI | InChI=1S/C18H23BrN4O3S/c1-2-22-12-17(21-13-22)27(25,26)23-9-7-15(8-10-23)18(24)20-11-14-3-5-16(19)6-4-14/h3-6,12-13,15H,2,7-11H2,1H3,(H,20,24) |
| InChIKey | WTAAKZLHEZPMRB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |