C25H28N4O3 — CID 53030540
3-[4,5-dimethyl-2-(2-methylphenyl)-7-oxopyrazolo[1,5-a]pyrimidin-6-yl]-N-[3-(furan-2-yl)propyl]propanamide (PubChem CID 53030540) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is 3-[4,5-dimethyl-2-(2-methylphenyl)-7-oxopyrazolo[1,5-a]pyrimidin-6-yl]-N-[3-(furan-2-yl)propyl]propanamide.
| Compound Name | 3-[4,5-dimethyl-2-(2-methylphenyl)-7-oxopyrazolo[1,5-a]pyrimidin-6-yl]-N-[3-(furan-2-yl)propyl]propanamide |
|---|---|
| PubChem CID | 53030540 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 3-[4,5-dimethyl-2-(2-methylphenyl)-7-oxopyrazolo[1,5-a]pyrimidin-6-yl]-N-[3-(furan-2-yl)propyl]propanamide |
| SMILES | Cc1ccccc1-c1cc2n(C)c(C)c(CCC(=O)NCCCc3ccco3)c(=O)n2n1 |
| InChI | InChI=1S/C25H28N4O3/c1-17-8-4-5-11-20(17)22-16-24-28(3)18(2)21(25(31)29(24)27-22)12-13-23(30)26-14-6-9-19-10-7-15-32-19/h4-5,7-8,10-11,15-16H,6,9,12-14H2,1-3H3,(H,26,30) |
| InChIKey | OFDXGRCWXRJYAD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|