C23H24ClN3O6S — CID 5303366
5-chloro-2-(2-morpholin-4-yl-2-oxoethoxy)-N-(2-quinolin-8-yloxyethyl)benzenesulfonamide (PubChem CID 5303366) has the molecular formula C23H24ClN3O6S and a molecular weight of 505.98 g/mol. Its IUPAC name is 5-chloro-2-(2-morpholin-4-yl-2-oxoethoxy)-N-(2-quinolin-8-yloxyethyl)benzenesulfonamide.
| Compound Name | 5-chloro-2-(2-morpholin-4-yl-2-oxoethoxy)-N-(2-quinolin-8-yloxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 5303366 |
| Molecular Formula | C23H24ClN3O6S |
| Molecular Weight | 505.98 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 5-chloro-2-(2-morpholin-4-yl-2-oxoethoxy)-N-(2-quinolin-8-yloxyethyl)benzenesulfonamide |
| SMILES | O=C(COc1ccc(Cl)cc1S(=O)(=O)NCCOc1cccc2cccnc12)N1CCOCC1 |
| InChI | InChI=1S/C23H24ClN3O6S/c24-18-6-7-19(33-16-22(28)27-10-13-31-14-11-27)21(15-18)34(29,30)26-9-12-32-20-5-1-3-17-4-2-8-25-23(17)20/h1-8,15,26H,9-14,16H2 |
| InChIKey | NEMBWCVZRLUSSI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.98 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|