C26H32N2O2 — CID 53034079
2-(4-benzyl-7-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)-N-[2-(cyclohexen-1-yl)ethyl]acetamide (PubChem CID 53034079) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is 2-(4-benzyl-7-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)-N-[2-(cyclohexen-1-yl)ethyl]acetamide.
| Compound Name | 2-(4-benzyl-7-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 53034079 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 2-(4-benzyl-7-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
| SMILES | Cc1ccc2c(c1)OCC(CC(=O)NCCC1=CCCCC1)N2Cc1ccccc1 |
| InChI | InChI=1S/C26H32N2O2/c1-20-12-13-24-25(16-20)30-19-23(28(24)18-22-10-6-3-7-11-22)17-26(29)27-15-14-21-8-4-2-5-9-21/h3,6-8,10-13,16,23H,2,4-5,9,14-15,17-19H2,1H3,(H,27,29) |
| InChIKey | KPYIUXCSXZBMDK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|