C24H30N2O2 — CID 95055807
2-[(3R)-4-benzyl-2,3-dihydro-1,4-benzoxazin-3-yl]-N-cycloheptylacetamide (PubChem CID 95055807) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-[(3R)-4-benzyl-2,3-dihydro-1,4-benzoxazin-3-yl]-N-cycloheptylacetamide.
| Compound Name | 2-[(3R)-4-benzyl-2,3-dihydro-1,4-benzoxazin-3-yl]-N-cycloheptylacetamide |
|---|---|
| PubChem CID | 95055807 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 2-[(3R)-4-benzyl-2,3-dihydro-1,4-benzoxazin-3-yl]-N-cycloheptylacetamide |
| SMILES | O=C(C[C@@H]1COc2ccccc2N1Cc1ccccc1)NC1CCCCCC1 |
| InChI | InChI=1S/C24H30N2O2/c27-24(25-20-12-6-1-2-7-13-20)16-21-18-28-23-15-9-8-14-22(23)26(21)17-19-10-4-3-5-11-19/h3-5,8-11,14-15,20-21H,1-2,6-7,12-13,16-18H2,(H,25,27)/t21-/m1/s1 |
| InChIKey | YUYHMCSVSDGZCC-OAQYLSRUSA-N |
| XLogP | 4.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |