About 2-(6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)-N-cycloheptylacetamide
2-(6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)-N-cycloheptylacetamide (PubChem CID 53034082) has the molecular formula C18H25ClN2O2
and a molecular weight of 336.86 g/mol. Its IUPAC name is 2-(6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)-N-cycloheptylacetamide.
Molecular Properties
| Compound Name | 2-(6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)-N-cycloheptylacetamide |
| PubChem CID | 53034082 |
| Molecular Formula | C18H25ClN2O2 |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-(6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)-N-cycloheptylacetamide |
| SMILES | CN1c2cc(Cl)ccc2OCC1CC(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C18H25ClN2O2/c1-21-15(12-23-17-9-8-13(19)10-16(17)21)11-18(22)20-14-6-4-2-3-5-7-14/h8-10,14-15H,2-7,11-12H2,1H3,(H,20,22) |
| InChIKey | BFTNAYCHPNZXKZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)-N-cycloheptylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)-N-cycloheptylacetamide?
The IUPAC name of 2-(6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)-N-cycloheptylacetamide (CID 53034082) is 2-(6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)-N-cycloheptylacetamide.
What is the SMILES notation for 2-(6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)-N-cycloheptylacetamide?
The canonical SMILES for 2-(6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)-N-cycloheptylacetamide is CN1c2cc(Cl)ccc2OCC1CC(=O)NC1CCCCCC1.
What is the InChIKey of 2-(6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)-N-cycloheptylacetamide?
The InChIKey is BFTNAYCHPNZXKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25ClN2O2/c1-21-15(12-23-17-9-8-13(19)10-16(17)21)11-18(22)20-14-6-4-2-3-5-7-14/h8-10,14-15H,2-7,11-12H2,1H3,(H,20,22).
What are the key properties of 2-(6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)-N-cycloheptylacetamide?
2-(6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)-N-cycloheptylacetamide has a molecular weight of 336.86 g/mol, XLogP of 3.77, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)-N-cycloheptylacetamide is sourced from PubChem (CID 53034082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).