C24H31N3O2 — CID 97043879
2-[(3R)-4-benzyl-2,3-dihydro-1,4-benzoxazin-3-yl]-N-(3-pyrrolidin-1-ylpropyl)acetamide (PubChem CID 97043879) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 2-[(3R)-4-benzyl-2,3-dihydro-1,4-benzoxazin-3-yl]-N-(3-pyrrolidin-1-ylpropyl)acetamide.
| Compound Name | 2-[(3R)-4-benzyl-2,3-dihydro-1,4-benzoxazin-3-yl]-N-(3-pyrrolidin-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 97043879 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 2-[(3R)-4-benzyl-2,3-dihydro-1,4-benzoxazin-3-yl]-N-(3-pyrrolidin-1-ylpropyl)acetamide |
| SMILES | O=C(C[C@@H]1COc2ccccc2N1Cc1ccccc1)NCCCN1CCCC1 |
| InChI | InChI=1S/C24H31N3O2/c28-24(25-13-8-16-26-14-6-7-15-26)17-21-19-29-23-12-5-4-11-22(23)27(21)18-20-9-2-1-3-10-20/h1-5,9-12,21H,6-8,13-19H2,(H,25,28)/t21-/m1/s1 |
| InChIKey | NZDTWMIXNZINNP-OAQYLSRUSA-N |
| XLogP | 3.45 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|