C23H14FN3O2 — CID 53034197
4-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylisoquinolin-1-one (PubChem CID 53034197) has the molecular formula C23H14FN3O2 and a molecular weight of 383.38 g/mol. Its IUPAC name is 4-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylisoquinolin-1-one.
| Compound Name | 4-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 53034197 |
| Molecular Formula | C23H14FN3O2 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 4-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylisoquinolin-1-one |
| SMILES | O=c1c2ccccc2c(-c2nc(-c3cccc(F)c3)no2)cn1-c1ccccc1 |
| InChI | InChI=1S/C23H14FN3O2/c24-16-8-6-7-15(13-16)21-25-22(29-26-21)20-14-27(17-9-2-1-3-10-17)23(28)19-12-5-4-11-18(19)20/h1-14H |
| InChIKey | FPTBKDXNKHJMNG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |