About 4-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylisoquinolin-1-one
4-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylisoquinolin-1-one (PubChem CID 53034201) has the molecular formula C23H14BrN3O2
and a molecular weight of 444.29 g/mol. Its IUPAC name is 4-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylisoquinolin-1-one.
Molecular Properties
| Compound Name | 4-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylisoquinolin-1-one |
| PubChem CID | 53034201 |
| Molecular Formula | C23H14BrN3O2 |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | 4-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylisoquinolin-1-one |
| SMILES | O=c1c2ccccc2c(-c2nc(-c3ccccc3Br)no2)cn1-c1ccccc1 |
| InChI | InChI=1S/C23H14BrN3O2/c24-20-13-7-6-12-18(20)21-25-22(29-26-21)19-14-27(15-8-2-1-3-9-15)23(28)17-11-5-4-10-16(17)19/h1-14H |
| InChIKey | WIFOJFTYUNJYPK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylisoquinolin-1-one?
The IUPAC name of 4-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylisoquinolin-1-one (CID 53034201) is 4-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylisoquinolin-1-one.
What is the SMILES notation for 4-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylisoquinolin-1-one?
The canonical SMILES for 4-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylisoquinolin-1-one is O=c1c2ccccc2c(-c2nc(-c3ccccc3Br)no2)cn1-c1ccccc1.
What is the InChIKey of 4-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylisoquinolin-1-one?
The InChIKey is WIFOJFTYUNJYPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14BrN3O2/c24-20-13-7-6-12-18(20)21-25-22(29-26-21)19-14-27(15-8-2-1-3-9-15)23(28)17-11-5-4-10-16(17)19/h1-14H.
What are the key properties of 4-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylisoquinolin-1-one?
4-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylisoquinolin-1-one has a molecular weight of 444.29 g/mol, XLogP of 5.47, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylisoquinolin-1-one is sourced from PubChem (CID 53034201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).