C26H24FN3O2 — CID 53036105
5-[3-cyclopentyl-5-(4-fluorophenyl)imidazol-4-yl]-N-(3-methylphenyl)furan-2-carboxamide (PubChem CID 53036105) has the molecular formula C26H24FN3O2 and a molecular weight of 429.50 g/mol. Its IUPAC name is 5-[3-cyclopentyl-5-(4-fluorophenyl)imidazol-4-yl]-N-(3-methylphenyl)furan-2-carboxamide.
| Compound Name | 5-[3-cyclopentyl-5-(4-fluorophenyl)imidazol-4-yl]-N-(3-methylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 53036105 |
| Molecular Formula | C26H24FN3O2 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 5-[3-cyclopentyl-5-(4-fluorophenyl)imidazol-4-yl]-N-(3-methylphenyl)furan-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2ccc(-c3c(-c4ccc(F)cc4)ncn3C3CCCC3)o2)c1 |
| InChI | InChI=1S/C26H24FN3O2/c1-17-5-4-6-20(15-17)29-26(31)23-14-13-22(32-23)25-24(18-9-11-19(27)12-10-18)28-16-30(25)21-7-2-3-8-21/h4-6,9-16,21H,2-3,7-8H2,1H3,(H,29,31) |
| InChIKey | AMTPPKYFTXUVJY-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |