C25H28FN3O2 — CID 53036147
[5-[3-cyclohexyl-5-(4-fluorophenyl)imidazol-4-yl]furan-2-yl]-piperidin-1-ylmethanone (PubChem CID 53036147) has the molecular formula C25H28FN3O2 and a molecular weight of 421.52 g/mol. Its IUPAC name is [5-[3-cyclohexyl-5-(4-fluorophenyl)imidazol-4-yl]furan-2-yl]-piperidin-1-ylmethanone.
| Compound Name | [5-[3-cyclohexyl-5-(4-fluorophenyl)imidazol-4-yl]furan-2-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 53036147 |
| Molecular Formula | C25H28FN3O2 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | [5-[3-cyclohexyl-5-(4-fluorophenyl)imidazol-4-yl]furan-2-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc(-c2c(-c3ccc(F)cc3)ncn2C2CCCCC2)o1)N1CCCCC1 |
| InChI | InChI=1S/C25H28FN3O2/c26-19-11-9-18(10-12-19)23-24(29(17-27-23)20-7-3-1-4-8-20)21-13-14-22(31-21)25(30)28-15-5-2-6-16-28/h9-14,17,20H,1-8,15-16H2 |
| InChIKey | MHXAOFNOFVMDKL-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 51.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |