C25H31N3O — CID 53036242
N-benzyl-1-[(1-ethyl-2-methylindol-3-yl)methyl]piperidine-4-carboxamide (PubChem CID 53036242) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is N-benzyl-1-[(1-ethyl-2-methylindol-3-yl)methyl]piperidine-4-carboxamide.
| Compound Name | N-benzyl-1-[(1-ethyl-2-methylindol-3-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53036242 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | N-benzyl-1-[(1-ethyl-2-methylindol-3-yl)methyl]piperidine-4-carboxamide |
| SMILES | CCn1c(C)c(CN2CCC(C(=O)NCc3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C25H31N3O/c1-3-28-19(2)23(22-11-7-8-12-24(22)28)18-27-15-13-21(14-16-27)25(29)26-17-20-9-5-4-6-10-20/h4-12,21H,3,13-18H2,1-2H3,(H,26,29) |
| InChIKey | FWXWOFUURWBPIN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|