C18H14BrFN2OS — CID 53037661
N-(4-bromo-2-fluorophenyl)-4-(2-ethyl-1,3-thiazol-4-yl)benzamide (PubChem CID 53037661) has the molecular formula C18H14BrFN2OS and a molecular weight of 405.29 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-4-(2-ethyl-1,3-thiazol-4-yl)benzamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-4-(2-ethyl-1,3-thiazol-4-yl)benzamide |
|---|---|
| PubChem CID | 53037661 |
| Molecular Formula | C18H14BrFN2OS |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-4-(2-ethyl-1,3-thiazol-4-yl)benzamide |
| SMILES | CCc1nc(-c2ccc(C(=O)Nc3ccc(Br)cc3F)cc2)cs1 |
| InChI | InChI=1S/C18H14BrFN2OS/c1-2-17-21-16(10-24-17)11-3-5-12(6-4-11)18(23)22-15-8-7-13(19)9-14(15)20/h3-10H,2H2,1H3,(H,22,23) |
| InChIKey | ZKIXWTYGMIUJNI-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |