C17H19FN2O3 — CID 53043103
1-ethyl-2-[2-[(3-fluorophenyl)methylamino]-2-oxoethyl]-4-methylpyrrole-3-carboxylic acid (PubChem CID 53043103) has the molecular formula C17H19FN2O3 and a molecular weight of 318.35 g/mol. Its IUPAC name is 1-ethyl-2-[2-[(3-fluorophenyl)methylamino]-2-oxoethyl]-4-methylpyrrole-3-carboxylic acid.
| Compound Name | 1-ethyl-2-[2-[(3-fluorophenyl)methylamino]-2-oxoethyl]-4-methylpyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 53043103 |
| Molecular Formula | C17H19FN2O3 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-ethyl-2-[2-[(3-fluorophenyl)methylamino]-2-oxoethyl]-4-methylpyrrole-3-carboxylic acid |
| SMILES | CCn1cc(C)c(C(=O)O)c1CC(=O)NCc1cccc(F)c1 |
| InChI | InChI=1S/C17H19FN2O3/c1-3-20-10-11(2)16(17(22)23)14(20)8-15(21)19-9-12-5-4-6-13(18)7-12/h4-7,10H,3,8-9H2,1-2H3,(H,19,21)(H,22,23) |
| InChIKey | QSXVDKAXCKFBJF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |