C17H19ClN2O3 — CID 53096040
2-[2-[(3-chlorophenyl)methylamino]-2-oxoethyl]-1-ethyl-4-methylpyrrole-3-carboxylic acid (PubChem CID 53096040) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is 2-[2-[(3-chlorophenyl)methylamino]-2-oxoethyl]-1-ethyl-4-methylpyrrole-3-carboxylic acid.
| Compound Name | 2-[2-[(3-chlorophenyl)methylamino]-2-oxoethyl]-1-ethyl-4-methylpyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 53096040 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-[2-[(3-chlorophenyl)methylamino]-2-oxoethyl]-1-ethyl-4-methylpyrrole-3-carboxylic acid |
| SMILES | CCn1cc(C)c(C(=O)O)c1CC(=O)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H19ClN2O3/c1-3-20-10-11(2)16(17(22)23)14(20)8-15(21)19-9-12-5-4-6-13(18)7-12/h4-7,10H,3,8-9H2,1-2H3,(H,19,21)(H,22,23) |
| InChIKey | XXRLJOISZJAVIX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |