C25H27N3O3 — CID 53044271
N-methyl-N-[[1-[4-(2-methylphenoxy)butyl]benzimidazol-2-yl]methyl]furan-2-carboxamide (PubChem CID 53044271) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-methyl-N-[[1-[4-(2-methylphenoxy)butyl]benzimidazol-2-yl]methyl]furan-2-carboxamide.
| Compound Name | N-methyl-N-[[1-[4-(2-methylphenoxy)butyl]benzimidazol-2-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 53044271 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-methyl-N-[[1-[4-(2-methylphenoxy)butyl]benzimidazol-2-yl]methyl]furan-2-carboxamide |
| SMILES | Cc1ccccc1OCCCCn1c(CN(C)C(=O)c2ccco2)nc2ccccc21 |
| InChI | InChI=1S/C25H27N3O3/c1-19-10-3-6-13-22(19)30-16-8-7-15-28-21-12-5-4-11-20(21)26-24(28)18-27(2)25(29)23-14-9-17-31-23/h3-6,9-14,17H,7-8,15-16,18H2,1-2H3 |
| InChIKey | HFGMETSFQCRKJI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 60.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|