C25H20N6O2 — CID 53045827
[4-[(5-methyl-2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]phenyl] 3-methylbenzoate (PubChem CID 53045827) has the molecular formula C25H20N6O2 and a molecular weight of 436.48 g/mol. Its IUPAC name is [4-[(5-methyl-2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]phenyl] 3-methylbenzoate.
| Compound Name | [4-[(5-methyl-2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 53045827 |
| Molecular Formula | C25H20N6O2 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | [4-[(5-methyl-2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]phenyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2ccc(Nc3cc(C)nc4nc(-c5cccnc5)nn34)cc2)c1 |
| InChI | InChI=1S/C25H20N6O2/c1-16-5-3-6-18(13-16)24(32)33-21-10-8-20(9-11-21)28-22-14-17(2)27-25-29-23(30-31(22)25)19-7-4-12-26-15-19/h3-15,28H,1-2H3 |
| InChIKey | NEMQNWAVJSPLTP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|