C26H24N8O — CID 53045966
N-[4-(dimethylamino)phenyl]-4-[(5-methyl-2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]benzamide (PubChem CID 53045966) has the molecular formula C26H24N8O and a molecular weight of 464.53 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-4-[(5-methyl-2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]benzamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-4-[(5-methyl-2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]benzamide |
|---|---|
| PubChem CID | 53045966 |
| Molecular Formula | C26H24N8O |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-4-[(5-methyl-2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]benzamide |
| SMILES | Cc1cc(Nc2ccc(C(=O)Nc3ccc(N(C)C)cc3)cc2)n2nc(-c3cccnc3)nc2n1 |
| InChI | InChI=1S/C26H24N8O/c1-17-15-23(34-26(28-17)31-24(32-34)19-5-4-14-27-16-19)29-20-8-6-18(7-9-20)25(35)30-21-10-12-22(13-11-21)33(2)3/h4-16,29H,1-3H3,(H,30,35) |
| InChIKey | RFMIYYIWZILQBG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 100.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|